C11H17BrIN3O — CID 110930285
1-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110930285) has the molecular formula C11H17BrIN3O and a molecular weight of 414.09 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110930285 |
| Molecular Formula | C11H17BrIN3O |
| Molecular Weight | 414.09 g/mol |
| Exact Mass | 412.96 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1cc(Br)ccc1OC.I |
| InChI | InChI=1S/C11H16BrN3O.HI/c1-13-11(14-2)15-7-8-6-9(12)4-5-10(8)16-3;/h4-6H,7H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | AIXBPYOQESZFOZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.09 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|