About [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten
[(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten (PubChem CID 11093097) has the molecular formula C16H24OSiW
and a molecular weight of 444.29 g/mol. Its IUPAC name is [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten.
Molecular Properties
| Compound Name | [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten |
| PubChem CID | 11093097 |
| Molecular Formula | C16H24OSiW |
| Molecular Weight | 444.29 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten |
| SMILES | COC(=[W])/C=C/CCC#CCCCC#C[Si](C)(C)C |
| InChI | InChI=1S/C16H24OSi.W/c1-17-15-13-11-9-7-5-6-8-10-12-14-16-18(2,3)4;/h11,13H,7-10,12H2,1-4H3;/b13-11+; |
| InChIKey | XWNALCRGLWZGLH-BNSHTTSQSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten?
The IUPAC name of [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten (CID 11093097) is [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten.
What is the SMILES notation for [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten?
The canonical SMILES for [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten is COC(=[W])/C=C/CCC#CCCCC#C[Si](C)(C)C.
What is the InChIKey of [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten?
The InChIKey is XWNALCRGLWZGLH-BNSHTTSQSA-N. The full InChI is InChI=1S/C16H24OSi.W/c1-17-15-13-11-9-7-5-6-8-10-12-14-16-18(2,3)4;/h11,13H,7-10,12H2,1-4H3;/b13-11+;.
What are the key properties of [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten?
[(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten has a molecular weight of 444.29 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-1-methoxy-12-trimethylsilyldodec-2-en-6,11-diynylidene]tungsten is sourced from PubChem (CID 11093097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).