C18H30OSi — CID 23181319
3-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-1-en-2-yl-trimethylsilane (PubChem CID 23181319) has the molecular formula C18H30OSi and a molecular weight of 290.52 g/mol. Its IUPAC name is 3-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-1-en-2-yl-trimethylsilane.
| Compound Name | 3-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-1-en-2-yl-trimethylsilane |
|---|---|
| PubChem CID | 23181319 |
| Molecular Formula | C18H30OSi |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 3-[(2E,6E)-2,6-dimethyldeca-2,6-dien-9-ynoxy]prop-1-en-2-yl-trimethylsilane |
| SMILES | C#CC/C=C(\C)CC/C=C(\C)COCC(=C)[Si](C)(C)C |
| InChI | InChI=1S/C18H30OSi/c1-8-9-11-16(2)12-10-13-17(3)14-19-15-18(4)20(5,6)7/h1,11,13H,4,9-10,12,14-15H2,2-3,5-7H3/b16-11+,17-13+ |
| InChIKey | JLKUSUHTTCVOQB-IUBLYSDUSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|