C25H42O2Si — CID 14138487
tert-butyl-dimethyl-[[(7E,11E,15E)-8,12,16-trimethyl-1-oxacycloheptadeca-7,11,15-trien-3-yn-6-yl]oxy]silane (PubChem CID 14138487) has the molecular formula C25H42O2Si and a molecular weight of 402.70 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(7E,11E,15E)-8,12,16-trimethyl-1-oxacycloheptadeca-7,11,15-trien-3-yn-6-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(7E,11E,15E)-8,12,16-trimethyl-1-oxacycloheptadeca-7,11,15-trien-3-yn-6-yl]oxy]silane |
|---|---|
| PubChem CID | 14138487 |
| Molecular Formula | C25H42O2Si |
| Molecular Weight | 402.70 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | tert-butyl-dimethyl-[[(7E,11E,15E)-8,12,16-trimethyl-1-oxacycloheptadeca-7,11,15-trien-3-yn-6-yl]oxy]silane |
| SMILES | C/C1=C\CC/C(C)=C/C(O[Si](C)(C)C(C)(C)C)CC#CCOC/C(C)=C/CC1 |
| InChI | InChI=1S/C25H42O2Si/c1-21-13-11-15-22(2)19-24(27-28(7,8)25(4,5)6)17-9-10-18-26-20-23(3)16-12-14-21/h13,16,19,24H,11-12,14-15,17-18,20H2,1-8H3/b21-13+,22-19+,23-16+ |
| InChIKey | DUNMRHIKMQCLTR-KZAJZWQFSA-N |
| XLogP | 7.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.70 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|