C21H36O2Si — CID 10760182
[(2E,9E)-4-methoxy-10,14-dimethylpentadeca-2,9,13-trien-5-yn-2-yl]oxy-trimethylsilane (PubChem CID 10760182) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is [(2E,9E)-4-methoxy-10,14-dimethylpentadeca-2,9,13-trien-5-yn-2-yl]oxy-trimethylsilane.
| Compound Name | [(2E,9E)-4-methoxy-10,14-dimethylpentadeca-2,9,13-trien-5-yn-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10760182 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | [(2E,9E)-4-methoxy-10,14-dimethylpentadeca-2,9,13-trien-5-yn-2-yl]oxy-trimethylsilane |
| SMILES | COC(C#CCC/C=C(\C)CCC=C(C)C)/C=C(\C)O[Si](C)(C)C |
| InChI | InChI=1S/C21H36O2Si/c1-18(2)13-12-15-19(3)14-10-9-11-16-21(22-5)17-20(4)23-24(6,7)8/h13-14,17,21H,9-10,12,15H2,1-8H3/b19-14+,20-17+ |
| InChIKey | IAWXHLNBIYHHFS-PDGSTHCXSA-N |
| XLogP | 6.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|