C16H26O2Si — CID 24773156
tert-butyl-[(E)-4-(1-methoxyethyl)hept-4-en-2,6-diynoxy]-dimethylsilane (PubChem CID 24773156) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is tert-butyl-[(E)-4-(1-methoxyethyl)hept-4-en-2,6-diynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-(1-methoxyethyl)hept-4-en-2,6-diynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 24773156 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | tert-butyl-[(E)-4-(1-methoxyethyl)hept-4-en-2,6-diynoxy]-dimethylsilane |
| SMILES | C#C/C=C(\C#CCO[Si](C)(C)C(C)(C)C)C(C)OC |
| InChI | InChI=1S/C16H26O2Si/c1-9-11-15(14(2)17-6)12-10-13-18-19(7,8)16(3,4)5/h1,11,14H,13H2,2-8H3/b15-11+ |
| InChIKey | XLNHVKMDDFSFEQ-RVDMUPIBSA-N |
| XLogP | 3.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|