C15H26O2Si — CID 10778199
(E)-8-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-6-ynal (PubChem CID 10778199) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is (E)-8-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-6-ynal.
| Compound Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-6-ynal |
|---|---|
| PubChem CID | 10778199 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (E)-8-[tert-butyl(dimethyl)silyl]oxy-5-methyloct-4-en-6-ynal |
| SMILES | C/C(C#CCO[Si](C)(C)C(C)(C)C)=C\CCC=O |
| InChI | InChI=1S/C15H26O2Si/c1-14(10-7-8-12-16)11-9-13-17-18(5,6)15(2,3)4/h10,12H,7-8,13H2,1-6H3/b14-10+ |
| InChIKey | TVFRWHVLUDZMTP-GXDHUFHOSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|