C27H46CrO2Si — CID 134940524
[(2E,6E,10E,12S)-1-methoxy-3,6,10-trimethyl-12-tri(propan-2-yl)silyloxytetradeca-2,6,10-trien-13-ynylidene]chromium (PubChem CID 134940524) has the molecular formula C27H46CrO2Si and a molecular weight of 482.75 g/mol. Its IUPAC name is [(2E,6E,10E,12S)-1-methoxy-3,6,10-trimethyl-12-tri(propan-2-yl)silyloxytetradeca-2,6,10-trien-13-ynylidene]chromium.
| Compound Name | [(2E,6E,10E,12S)-1-methoxy-3,6,10-trimethyl-12-tri(propan-2-yl)silyloxytetradeca-2,6,10-trien-13-ynylidene]chromium |
|---|---|
| PubChem CID | 134940524 |
| Molecular Formula | C27H46CrO2Si |
| Molecular Weight | 482.75 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | [(2E,6E,10E,12S)-1-methoxy-3,6,10-trimethyl-12-tri(propan-2-yl)silyloxytetradeca-2,6,10-trien-13-ynylidene]chromium |
| SMILES | C#C[C@H](/C=C(\C)CC/C=C(\C)CC/C(C)=C/C(=[Cr])OC)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H46O2Si.Cr/c1-12-27(29-30(21(2)3,22(4)5)23(6)7)20-26(10)15-13-14-24(8)16-17-25(9)18-19-28-11;/h1,14,18,20-23,27H,13,15-17H2,2-11H3;/b24-14+,25-18+,26-20+;/t27-;/m1./s1 |
| InChIKey | JRJDSSPELCXNJA-SYKKEWNHSA-N |
| XLogP | 7.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.75 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|