C36H72O2Si2 — CID 11093164
tert-butyl-[(4E,6E,8S,9E,12R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8,10,12-hexamethyloctadeca-4,6,9-trienoxy]-dimethylsilane (PubChem CID 11093164) has the molecular formula C36H72O2Si2 and a molecular weight of 593.14 g/mol. Its IUPAC name is tert-butyl-[(4E,6E,8S,9E,12R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8,10,12-hexamethyloctadeca-4,6,9-trienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4E,6E,8S,9E,12R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8,10,12-hexamethyloctadeca-4,6,9-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11093164 |
| Molecular Formula | C36H72O2Si2 |
| Molecular Weight | 593.14 g/mol |
| Exact Mass | 592.51 |
| IUPAC Name | tert-butyl-[(4E,6E,8S,9E,12R)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6,8,10,12-hexamethyloctadeca-4,6,9-trienoxy]-dimethylsilane |
| SMILES | CCCCCC[C@@H](C)C/C(C)=C/[C@H](C)/C=C(C)/C=C/C(O[Si](C)(C)C(C)(C)C)C(C)(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H72O2Si2/c1-18-19-20-21-22-29(2)25-31(4)27-32(5)26-30(3)23-24-33(38-40(16,17)35(9,10)11)36(12,13)28-37-39(14,15)34(6,7)8/h23-24,26-27,29,32-33H,18-22,25,28H2,1-17H3/b24-23+,30-26+,31-27+/t29-,32-,33?/m1/s1 |
| InChIKey | VNNNFPRZRPYEJF-JXWNABECSA-N |
| XLogP | 12.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.14 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|