C22H34N4O3 — CID 110937302
2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine (PubChem CID 110937302) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine.
| Compound Name | 2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110937302 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 2-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methyl]-1-ethyl-3-(furan-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCCN(CC)CC)c(OC)c1)NCc1ccco1 |
| InChI | InChI=1S/C22H34N4O3/c1-5-23-22(25-17-19-9-8-13-28-19)24-16-18-10-11-20(21(15-18)27-4)29-14-12-26(6-2)7-3/h8-11,13,15H,5-7,12,14,16-17H2,1-4H3,(H2,23,24,25) |
| InChIKey | AGQVIQXVTSEYFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|