C15H24N6OS — CID 110940698
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methoxyethyl)-3-(1-thiophen-2-ylethyl)guanidine (PubChem CID 110940698) has the molecular formula C15H24N6OS and a molecular weight of 336.47 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methoxyethyl)-3-(1-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methoxyethyl)-3-(1-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 110940698 |
| Molecular Formula | C15H24N6OS |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methoxyethyl)-3-(1-thiophen-2-ylethyl)guanidine |
| SMILES | COCCN/C(=N\Cc1nnc(C)n1C)NC(C)c1cccs1 |
| InChI | InChI=1S/C15H24N6OS/c1-11(13-6-5-9-23-13)18-15(16-7-8-22-4)17-10-14-20-19-12(2)21(14)3/h5-6,9,11H,7-8,10H2,1-4H3,(H2,16,17,18) |
| InChIKey | DNUKBWLNYBKGKT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|