C12H22IN3S — CID 110945219
1-butan-2-yl-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 110945219) has the molecular formula C12H22IN3S and a molecular weight of 367.30 g/mol. Its IUPAC name is 1-butan-2-yl-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110945219 |
| Molecular Formula | C12H22IN3S |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 1-butan-2-yl-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCC(C)N/C(=N\C)NCc1sccc1C.I |
| InChI | InChI=1S/C12H21N3S.HI/c1-5-10(3)15-12(13-4)14-8-11-9(2)6-7-16-11;/h6-7,10H,5,8H2,1-4H3,(H2,13,14,15);1H |
| InChIKey | SYRYIMRAVFIXJM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|