C18H28N4 — CID 110955650
N-ethyl-N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 110955650) has the molecular formula C18H28N4 and a molecular weight of 300.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110955650 |
| Molecular Formula | C18H28N4 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | N-ethyl-N'-[2-(2-methyl-2,3-dihydroindol-1-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN1c2ccccc2CC1C)N1CCCC1 |
| InChI | InChI=1S/C18H28N4/c1-3-19-18(21-11-6-7-12-21)20-10-13-22-15(2)14-16-8-4-5-9-17(16)22/h4-5,8-9,15H,3,6-7,10-14H2,1-2H3,(H,19,20) |
| InChIKey | DUGMPGVUVXGPMI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|