C11H13NO3 — CID 11095803
(3aS,5aS,9aS)-3a,4,5,5a,9,9a-hexahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione (PubChem CID 11095803) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (3aS,5aS,9aS)-3a,4,5,5a,9,9a-hexahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione.
| Compound Name | (3aS,5aS,9aS)-3a,4,5,5a,9,9a-hexahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione |
|---|---|
| PubChem CID | 11095803 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3aS,5aS,9aS)-3a,4,5,5a,9,9a-hexahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione |
| SMILES | O=C1C=C[C@@H]2CC[C@H]3COC(=O)N3[C@H]2C1 |
| InChI | InChI=1S/C11H13NO3/c13-9-4-2-7-1-3-8-6-15-11(14)12(8)10(7)5-9/h2,4,7-8,10H,1,3,5-6H2/t7-,8-,10-/m0/s1 |
| InChIKey | GKKZQNPAVQIJJP-NRPADANISA-N |
| XLogP | 1.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |