C12H17NO3 — CID 101195543
(3aR,5aR,6S,9aS)-6-methyl-3a,4,5,5a,6,7,9,9a-octahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione (PubChem CID 101195543) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (3aR,5aR,6S,9aS)-6-methyl-3a,4,5,5a,6,7,9,9a-octahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione.
| Compound Name | (3aR,5aR,6S,9aS)-6-methyl-3a,4,5,5a,6,7,9,9a-octahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione |
|---|---|
| PubChem CID | 101195543 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (3aR,5aR,6S,9aS)-6-methyl-3a,4,5,5a,6,7,9,9a-octahydro-3H-[1,3]oxazolo[3,4-a]quinoline-1,8-dione |
| SMILES | C[C@H]1CC(=O)C[C@H]2[C@@H]1CC[C@@H]1COC(=O)N12 |
| InChI | InChI=1S/C12H17NO3/c1-7-4-9(14)5-11-10(7)3-2-8-6-16-12(15)13(8)11/h7-8,10-11H,2-6H2,1H3/t7-,8+,10+,11-/m0/s1 |
| InChIKey | WENPJXUUXVWDRN-URPMGSGRSA-N |
| XLogP | 1.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |