C18H27N5 — CID 110958559
1-cyclohexyl-3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine (PubChem CID 110958559) has the molecular formula C18H27N5 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-cyclohexyl-3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine.
| Compound Name | 1-cyclohexyl-3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 110958559 |
| Molecular Formula | C18H27N5 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-cyclohexyl-3-ethyl-2-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CCc1cn2ccccc2n1)NC1CCCCC1 |
| InChI | InChI=1S/C18H27N5/c1-2-19-18(22-15-8-4-3-5-9-15)20-12-11-16-14-23-13-7-6-10-17(23)21-16/h6-7,10,13-15H,2-5,8-9,11-12H2,1H3,(H2,19,20,22) |
| InChIKey | UXGMUIWBUCBZOH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|