C11H8N6 — CID 11096228
10-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaene (PubChem CID 11096228) has the molecular formula C11H8N6 and a molecular weight of 224.23 g/mol. Its IUPAC name is 10-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaene.
| Compound Name | 10-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaene |
|---|---|
| PubChem CID | 11096228 |
| Molecular Formula | C11H8N6 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 10-methyl-8,10,12,13,15,16-hexazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2,4,6,8,11,13-heptaene |
| SMILES | Cn1c2nc3ccccc3c-2nn2cnnc12 |
| InChI | InChI=1S/C11H8N6/c1-16-10-9(15-17-6-12-14-11(16)17)7-4-2-3-5-8(7)13-10/h2-6H,1H3 |
| InChIKey | ILBMOPXELPMVMT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |