C19H28N4O3 — CID 110962751
4-acetyl-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-N-ethylpiperazine-1-carboximidamide (PubChem CID 110962751) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-acetyl-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-acetyl-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110962751 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 4-acetyl-N'-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCCCO2)N1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C19H28N4O3/c1-3-20-19(23-9-7-22(8-10-23)15(2)24)21-14-16-5-6-17-18(13-16)26-12-4-11-25-17/h5-6,13H,3-4,7-12,14H2,1-2H3,(H,20,21) |
| InChIKey | MWDVWZWMLWARDU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|