C14H22BrFIN3 — CID 110967221
2-[(2-bromo-5-fluorophenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide (PubChem CID 110967221) has the molecular formula C14H22BrFIN3 and a molecular weight of 458.16 g/mol. Its IUPAC name is 2-[(2-bromo-5-fluorophenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(2-bromo-5-fluorophenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110967221 |
| Molecular Formula | C14H22BrFIN3 |
| Molecular Weight | 458.16 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | 2-[(2-bromo-5-fluorophenyl)methyl]-1-tert-butyl-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1Br)NC(C)(C)C.I |
| InChI | InChI=1S/C14H21BrFN3.HI/c1-5-17-13(19-14(2,3)4)18-9-10-8-11(16)6-7-12(10)15;/h6-8H,5,9H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | HJSWMAQHDRSSBP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|