C12H18O5 — CID 11096781
(4E)-4-[(4S)-4-(methoxymethoxy)-2-oxooxolan-3-ylidene]-2,2-dimethylbutanal (PubChem CID 11096781) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (4E)-4-[(4S)-4-(methoxymethoxy)-2-oxooxolan-3-ylidene]-2,2-dimethylbutanal.
| Compound Name | (4E)-4-[(4S)-4-(methoxymethoxy)-2-oxooxolan-3-ylidene]-2,2-dimethylbutanal |
|---|---|
| PubChem CID | 11096781 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (4E)-4-[(4S)-4-(methoxymethoxy)-2-oxooxolan-3-ylidene]-2,2-dimethylbutanal |
| SMILES | COCO[C@@H]1COC(=O)/C1=C/CC(C)(C)C=O |
| InChI | InChI=1S/C12H18O5/c1-12(2,7-13)5-4-9-10(17-8-15-3)6-16-11(9)14/h4,7,10H,5-6,8H2,1-3H3/b9-4+/t10-/m1/s1 |
| InChIKey | XJCGMVKVVSVDJW-WXLQGSQKSA-N |
| XLogP | 1.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|