C14H22O5 — CID 23257263
ethyl (E)-4-[2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylbut-2-enoate (PubChem CID 23257263) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is ethyl (E)-4-[2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylbut-2-enoate.
| Compound Name | ethyl (E)-4-[2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 23257263 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | ethyl (E)-4-[2,2-dimethyl-4-(2-oxoethyl)-1,3-dioxolan-4-yl]-2-methylbut-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CC1(CC=O)COC(C)(C)O1 |
| InChI | InChI=1S/C14H22O5/c1-5-17-12(16)11(2)6-7-14(8-9-15)10-18-13(3,4)19-14/h6,9H,5,7-8,10H2,1-4H3/b11-6+ |
| InChIKey | RXYIMKCMQPVRCX-IZZDOVSWSA-N |
| XLogP | 2.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|