C22H32IN5O3 — CID 110972754
N-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 110972754) has the molecular formula C22H32IN5O3 and a molecular weight of 541.43 g/mol. Its IUPAC name is N-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 110972754 |
| Molecular Formula | C22H32IN5O3 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | N-[3-[[[ethylamino-(3-morpholin-4-ylpropylamino)methylidene]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)c2ccco2)c1)NCCCN1CCOCC1.I |
| InChI | InChI=1S/C22H31N5O3.HI/c1-2-23-22(24-9-5-10-27-11-14-29-15-12-27)25-17-18-6-3-7-19(16-18)26-21(28)20-8-4-13-30-20;/h3-4,6-8,13,16H,2,5,9-12,14-15,17H2,1H3,(H,26,28)(H2,23,24,25);1H |
| InChIKey | NXQNCYQCYNHTBQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|