C16H27NO2 — CID 11097462
(9R,9aR)-3-methoxy-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one (PubChem CID 11097462) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is (9R,9aR)-3-methoxy-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one.
| Compound Name | (9R,9aR)-3-methoxy-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one |
|---|---|
| PubChem CID | 11097462 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (9R,9aR)-3-methoxy-9-propan-2-yl-9a-prop-2-enyl-2,3,6,7,8,9-hexahydro-1H-pyrrolo[1,2-a]azepin-5-one |
| SMILES | C=CC[C@@]12CCC(OC)N1C(=O)CCC[C@@H]2C(C)C |
| InChI | InChI=1S/C16H27NO2/c1-5-10-16-11-9-15(19-4)17(16)14(18)8-6-7-13(16)12(2)3/h5,12-13,15H,1,6-11H2,2-4H3/t13-,15?,16+/m1/s1 |
| InChIKey | GKEZRTKUXGEQKG-BXCKNWRKSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|