C13H29IN4 — CID 110981524
1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide (PubChem CID 110981524) has the molecular formula C13H29IN4 and a molecular weight of 368.31 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110981524 |
| Molecular Formula | C13H29IN4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-2-methyl-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCCN(C(C)C)C(C)C.I |
| InChI | InChI=1S/C13H28N4.HI/c1-7-8-15-13(14-6)16-9-10-17(11(2)3)12(4)5;/h7,11-12H,1,8-10H2,2-6H3,(H2,14,15,16);1H |
| InChIKey | NAXIWOLJOCCANW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|