C12H22N4 — CID 90847682
1-(1-but-2-enyl-4-methyl-4,5-dihydroimidazol-2-yl)piperazine (PubChem CID 90847682) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-(1-but-2-enyl-4-methyl-4,5-dihydroimidazol-2-yl)piperazine.
| Compound Name | 1-(1-but-2-enyl-4-methyl-4,5-dihydroimidazol-2-yl)piperazine |
|---|---|
| PubChem CID | 90847682 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-(1-but-2-enyl-4-methyl-4,5-dihydroimidazol-2-yl)piperazine |
| SMILES | CC=CCN1CC(C)N=C1N1CCNCC1 |
| InChI | InChI=1S/C12H22N4/c1-3-4-7-16-10-11(2)14-12(16)15-8-5-13-6-9-15/h3-4,11,13H,5-10H2,1-2H3 |
| InChIKey | FOSOYUCFKZYLEP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|