C11H21N5 — CID 137139798
N,N,6,7-tetramethyl-2-prop-2-enylimino-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine (PubChem CID 137139798) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is N,N,6,7-tetramethyl-2-prop-2-enylimino-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine.
| Compound Name | N,N,6,7-tetramethyl-2-prop-2-enylimino-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine |
|---|---|
| PubChem CID | 137139798 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | N,N,6,7-tetramethyl-2-prop-2-enylimino-1,3,6,7-tetrahydro-1,3,5-triazepin-4-amine |
| SMILES | C=CC/N=C1/NC(N(C)C)=NC(C)C(C)N1 |
| InChI | InChI=1S/C11H21N5/c1-6-7-12-10-13-8(2)9(3)14-11(15-10)16(4)5/h6,8-9H,1,7H2,2-5H3,(H2,12,13,14,15) |
| InChIKey | RNIOYVUGHCPMFY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|