C12H25N5 — CID 54738276
2-[2-(4-methylpiperazin-1-yl)propyl]-1-prop-2-enylguanidine (PubChem CID 54738276) has the molecular formula C12H25N5 and a molecular weight of 239.37 g/mol. Its IUPAC name is 2-[2-(4-methylpiperazin-1-yl)propyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[2-(4-methylpiperazin-1-yl)propyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 54738276 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | 2-[2-(4-methylpiperazin-1-yl)propyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CC(C)N1CCN(C)CC1 |
| InChI | InChI=1S/C12H25N5/c1-4-5-14-12(13)15-10-11(2)17-8-6-16(3)7-9-17/h4,11H,1,5-10H2,2-3H3,(H3,13,14,15) |
| InChIKey | UMBWEWGWOWTBRS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|