C13H24N4 — CID 91388993
1-[4-methyl-1-(3-methylbut-2-enyl)-4,5-dihydroimidazol-2-yl]piperazine (PubChem CID 91388993) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[4-methyl-1-(3-methylbut-2-enyl)-4,5-dihydroimidazol-2-yl]piperazine.
| Compound Name | 1-[4-methyl-1-(3-methylbut-2-enyl)-4,5-dihydroimidazol-2-yl]piperazine |
|---|---|
| PubChem CID | 91388993 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 1-[4-methyl-1-(3-methylbut-2-enyl)-4,5-dihydroimidazol-2-yl]piperazine |
| SMILES | CC(C)=CCN1CC(C)N=C1N1CCNCC1 |
| InChI | InChI=1S/C13H24N4/c1-11(2)4-7-17-10-12(3)15-13(17)16-8-5-14-6-9-16/h4,12,14H,5-10H2,1-3H3 |
| InChIKey | DUCVBENGJHZSQV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|