C15H27N7 — CID 142101601
1-methylidene-3-[(Z)-N'-[(4-methylpiperazin-1-yl)methyl]-N-prop-2-enylcarbamimidoyl]-2-prop-2-enylguanidine (PubChem CID 142101601) has the molecular formula C15H27N7 and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-methylidene-3-[(Z)-N'-[(4-methylpiperazin-1-yl)methyl]-N-prop-2-enylcarbamimidoyl]-2-prop-2-enylguanidine.
| Compound Name | 1-methylidene-3-[(Z)-N'-[(4-methylpiperazin-1-yl)methyl]-N-prop-2-enylcarbamimidoyl]-2-prop-2-enylguanidine |
|---|---|
| PubChem CID | 142101601 |
| Molecular Formula | C15H27N7 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 1-methylidene-3-[(Z)-N'-[(4-methylpiperazin-1-yl)methyl]-N-prop-2-enylcarbamimidoyl]-2-prop-2-enylguanidine |
| SMILES | C=CC/N=C(\N=C)N/C(=N\CN1CCN(C)CC1)NCC=C |
| InChI | InChI=1S/C15H27N7/c1-5-7-17-14(16-3)20-15(18-8-6-2)19-13-22-11-9-21(4)10-12-22/h5-6H,1-3,7-13H2,4H3,(H2,17,18,19,20) |
| InChIKey | PVSPNXNJTVYZPN-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 67.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|