C13H26N4 — CID 156641310
ethane;2-(4-propan-2-ylpiperazin-1-yl)-1,4-dihydropyrimidine (PubChem CID 156641310) has the molecular formula C13H26N4 and a molecular weight of 238.38 g/mol. Its IUPAC name is ethane;2-(4-propan-2-ylpiperazin-1-yl)-1,4-dihydropyrimidine.
| Compound Name | ethane;2-(4-propan-2-ylpiperazin-1-yl)-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 156641310 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | ethane;2-(4-propan-2-ylpiperazin-1-yl)-1,4-dihydropyrimidine |
| SMILES | CC.CC(C)N1CCN(C2=NCC=CN2)CC1 |
| InChI | InChI=1S/C11H20N4.C2H6/c1-10(2)14-6-8-15(9-7-14)11-12-4-3-5-13-11;1-2/h3-4,10H,5-9H2,1-2H3,(H,12,13);1-2H3 |
| InChIKey | QAAIBCAEWVBYDO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |