C8H14N4 — CID 91011480
4-piperazin-1-yl-1,4-dihydropyrimidine (PubChem CID 91011480) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 4-piperazin-1-yl-1,4-dihydropyrimidine.
| Compound Name | 4-piperazin-1-yl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 91011480 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 4-piperazin-1-yl-1,4-dihydropyrimidine |
| SMILES | C1=CC(N2CCNCC2)N=CN1 |
| InChI | InChI=1S/C8H14N4/c1-2-10-7-11-8(1)12-5-3-9-4-6-12/h1-2,7-9H,3-6H2,(H,10,11) |
| InChIKey | IDEUQSRHHIDRDZ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |