C11H22F3IN4 — CID 136926188
1-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-prop-2-enylguanidine;hydroiodide (PubChem CID 136926188) has the molecular formula C11H22F3IN4 and a molecular weight of 394.22 g/mol. Its IUPAC name is 1-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-prop-2-enylguanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136926188 |
| Molecular Formula | C11H22F3IN4 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 1-ethyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-3-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(=N/CCN(C)CC(F)(F)F)NCC.I |
| InChI | InChI=1S/C11H21F3N4.HI/c1-4-6-16-10(15-5-2)17-7-8-18(3)9-11(12,13)14;/h4H,1,5-9H2,2-3H3,(H2,15,16,17);1H |
| InChIKey | BAHBPPLJXUQIEG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|