C14H28F3IN4 — CID 109497369
3-ethyl-1-methyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109497369) has the molecular formula C14H28F3IN4 and a molecular weight of 436.30 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109497369 |
| Molecular Formula | C14H28F3IN4 |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\CCN(C)CC(F)(F)F)NCC.I |
| InChI | InChI=1S/C14H27F3N4.HI/c1-5-7-8-10-21(4)13(18-6-2)19-9-11-20(3)12-14(15,16)17;/h5H,1,6-12H2,2-4H3,(H,18,19);1H |
| InChIKey | MBQRUVJKLRTENE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|