C11H21F3N4 — CID 110982049
2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-prop-2-enylguanidine (PubChem CID 110982049) has the molecular formula C11H21F3N4 and a molecular weight of 266.31 g/mol. Its IUPAC name is 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-prop-2-enylguanidine.
| Compound Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 110982049 |
| Molecular Formula | C11H21F3N4 |
| Molecular Weight | 266.31 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 2-methyl-1-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\C)NCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C11H21F3N4/c1-4-6-16-10(15-2)17-7-5-8-18(3)9-11(12,13)14/h4H,1,5-9H2,2-3H3,(H2,15,16,17) |
| InChIKey | SOSPQNDWJFVLIC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.31 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|