C21H28N4O — CID 110984520
N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide (PubChem CID 110984520) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 110984520 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-methoxyphenyl)ethyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccc(OC)cc1)N(C)C)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H28N4O/c1-22-21(25-14-13-16-7-5-6-8-19(16)25)23-15-20(24(2)3)17-9-11-18(26-4)12-10-17/h5-12,20H,13-15H2,1-4H3,(H,22,23) |
| InChIKey | QMHMQSKLSRMPDM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|