C23H30IN3O2 — CID 110983513
N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide (PubChem CID 110983513) has the molecular formula C23H30IN3O2 and a molecular weight of 507.42 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide.
| Compound Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110983513 |
| Molecular Formula | C23H30IN3O2 |
| Molecular Weight | 507.42 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-2,3-dihydroindole-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1(c2ccc(OC)cc2)CCOCC1)N1CCc2ccccc21.I |
| InChI | InChI=1S/C23H29N3O2.HI/c1-24-22(26-14-11-18-5-3-4-6-21(18)26)25-17-23(12-15-28-16-13-23)19-7-9-20(27-2)10-8-19;/h3-10H,11-17H2,1-2H3,(H,24,25);1H |
| InChIKey | WVGSJGOSPIAEGI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|