C24H36N4O4 — CID 111302403
N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide (PubChem CID 111302403) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide.
| Compound Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111302403 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | N-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-N'-methyl-4-(oxolane-2-carbonyl)piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2ccc(OC)cc2)CCOCC1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C24H36N4O4/c1-25-23(28-13-11-27(12-14-28)22(29)21-4-3-15-32-21)26-18-24(9-16-31-17-10-24)19-5-7-20(30-2)8-6-19/h5-8,21H,3-4,9-18H2,1-2H3,(H,25,26) |
| InChIKey | JBNMDEUTMRCQFC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|