C24H29FN4O — CID 110985784
1-(1-benzylpiperidin-4-yl)-3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methylguanidine (PubChem CID 110985784) has the molecular formula C24H29FN4O and a molecular weight of 408.52 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methylguanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110985784 |
| Molecular Formula | C24H29FN4O |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[(5-fluoro-3-methyl-1-benzofuran-2-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1oc2ccc(F)cc2c1C)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29FN4O/c1-17-21-14-19(25)8-9-22(21)30-23(17)15-27-24(26-2)28-20-10-12-29(13-11-20)16-18-6-4-3-5-7-18/h3-9,14,20H,10-13,15-16H2,1-2H3,(H2,26,27,28) |
| InChIKey | DTUUAIUVCOUTBZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|