C24H33ClIN5O — CID 110986311
3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide (PubChem CID 110986311) has the molecular formula C24H33ClIN5O and a molecular weight of 569.92 g/mol. Its IUPAC name is 3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide.
| Compound Name | 3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide |
|---|---|
| PubChem CID | 110986311 |
| Molecular Formula | C24H33ClIN5O |
| Molecular Weight | 569.92 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 3-[[N-(1-benzylpiperidin-4-yl)-N'-methylcarbamimidoyl]amino]-N-(3-chloro-2-methylphenyl)propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)Nc1cccc(Cl)c1C)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C24H32ClN5O.HI/c1-18-21(25)9-6-10-22(18)29-23(31)11-14-27-24(26-2)28-20-12-15-30(16-13-20)17-19-7-4-3-5-8-19;/h3-10,20H,11-17H2,1-2H3,(H,29,31)(H2,26,27,28);1H |
| InChIKey | RTUWOKMAIYCEGP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.92 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|