C18H30O2Si — CID 11098826
(E,2S)-2-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]pent-3-en-2-ol (PubChem CID 11098826) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (E,2S)-2-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]pent-3-en-2-ol.
| Compound Name | (E,2S)-2-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]pent-3-en-2-ol |
|---|---|
| PubChem CID | 11098826 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (E,2S)-2-[tert-butyl-methyl-(phenylmethoxymethyl)silyl]pent-3-en-2-ol |
| SMILES | C/C=C/[C@@](C)(O)[Si@@](C)(COCc1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C18H30O2Si/c1-7-13-18(5,19)21(6,17(2,3)4)15-20-14-16-11-9-8-10-12-16/h7-13,19H,14-15H2,1-6H3/b13-7+/t18-,21-/m0/s1 |
| InChIKey | NSGDMWZHPXRGGB-IIFKNWAHSA-N |
| XLogP | 4.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|