C21H35IN4O4S — CID 110993236
ethyl 1-[N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993236) has the molecular formula C21H35IN4O4S and a molecular weight of 566.51 g/mol. Its IUPAC name is ethyl 1-[N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993236 |
| Molecular Formula | C21H35IN4O4S |
| Molecular Weight | 566.51 g/mol |
| Exact Mass | 566.14 |
| IUPAC Name | ethyl 1-[N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-N'-methylcarbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N\C)NCc2ccccc2S(=O)(=O)NC(C)(C)C)C1.I |
| InChI | InChI=1S/C21H34N4O4S.HI/c1-6-29-19(26)17-11-9-13-25(15-17)20(22-5)23-14-16-10-7-8-12-18(16)30(27,28)24-21(2,3)4;/h7-8,10,12,17,24H,6,9,11,13-15H2,1-5H3,(H,22,23);1H |
| InChIKey | MTQILKIFVMRAGV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|