C20H35IN4O3S — CID 111958398
N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111958398) has the molecular formula C20H35IN4O3S and a molecular weight of 538.50 g/mol. Its IUPAC name is N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111958398 |
| Molecular Formula | C20H35IN4O3S |
| Molecular Weight | 538.50 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | N-[[2-(tert-butylsulfamoyl)phenyl]methyl]-4-ethoxy-N'-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N\C)NCc2ccccc2S(=O)(=O)NC(C)(C)C)CC1.I |
| InChI | InChI=1S/C20H34N4O3S.HI/c1-6-27-17-11-13-24(14-12-17)19(21-5)22-15-16-9-7-8-10-18(16)28(25,26)23-20(2,3)4;/h7-10,17,23H,6,11-15H2,1-5H3,(H,21,22);1H |
| InChIKey | LJWRTYNLZGVJGR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|