C22H36IN5O — CID 110997234
1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110997234) has the molecular formula C22H36IN5O and a molecular weight of 513.47 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110997234 |
| Molecular Formula | C22H36IN5O |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.20 |
| IUPAC Name | 1-[2-(2,6-dimethylmorpholin-4-yl)-2-methylpropyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCC(C)(C)N1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C22H35N5O.HI/c1-16-13-27(14-17(2)28-16)22(3,4)15-26-21(23-5)24-11-10-18-12-25-20-9-7-6-8-19(18)20;/h6-9,12,16-17,25H,10-11,13-15H2,1-5H3,(H2,23,24,26);1H |
| InChIKey | KWGFBPKPOCGMFB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|