C21H24N4 — CID 110997297
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 110997297) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110997297 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCC1Cc2ccccc21 |
| InChI | InChI=1S/C21H24N4/c1-22-21(25-14-17-12-15-6-2-3-7-18(15)17)23-11-10-16-13-24-20-9-5-4-8-19(16)20/h2-9,13,17,24H,10-12,14H2,1H3,(H2,22,23,25) |
| InChIKey | QSFKFWDGTYBBPB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|