C16H14F5NO2 — CID 11100094
(E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]pent-2-enenitrile (PubChem CID 11100094) has the molecular formula C16H14F5NO2 and a molecular weight of 347.28 g/mol. Its IUPAC name is (E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]pent-2-enenitrile.
| Compound Name | (E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]pent-2-enenitrile |
|---|---|
| PubChem CID | 11100094 |
| Molecular Formula | C16H14F5NO2 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (E)-3-ethoxy-4,4,5,5,5-pentafluoro-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]pent-2-enenitrile |
| SMILES | CCO/C(=C(\C#N)C(O)/C=C/c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H14F5NO2/c1-2-24-14(15(17,18)16(19,20)21)12(10-22)13(23)9-8-11-6-4-3-5-7-11/h3-9,13,23H,2H2,1H3/b9-8+,14-12+ |
| InChIKey | FKQIUGVELYDTHY-CHBKHGQFSA-N |
| XLogP | 4.07 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|