C22H38IN7OS — CID 111008788
1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide (PubChem CID 111008788) has the molecular formula C22H38IN7OS and a molecular weight of 575.57 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111008788 |
| Molecular Formula | C22H38IN7OS |
| Molecular Weight | 575.57 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methyl-3-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1nnc(SC)n1CC(C)C)NCC(c1ccco1)N1CCCC1.I |
| InChI | InChI=1S/C22H37N7OS.HI/c1-17(2)16-29-20(26-27-22(29)31-4)10-7-11-24-21(23-3)25-15-18(19-9-8-14-30-19)28-12-5-6-13-28;/h8-9,14,17-18H,5-7,10-13,15-16H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | QDDBVTWJZOZFKY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|