C20H30IN7S — CID 111013664
1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111013664) has the molecular formula C20H30IN7S and a molecular weight of 527.48 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111013664 |
| Molecular Formula | C20H30IN7S |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 1-[2-(diethylamino)-2-thiophen-3-ylethyl]-3-ethyl-2-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc2ccccn12)NCC(c1ccsc1)N(CC)CC.I |
| InChI | InChI=1S/C20H29N7S.HI/c1-4-21-20(23-14-19-25-24-18-9-7-8-11-27(18)19)22-13-17(26(5-2)6-3)16-10-12-28-15-16;/h7-12,15,17H,4-6,13-14H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | LKPUDPWQNIALMG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|