C21H29N7O — CID 111013855
2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111013855) has the molecular formula C21H29N7O and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111013855 |
| Molecular Formula | C21H29N7O |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 2-[[2-[2-(dimethylamino)ethoxy]phenyl]methyl]-1-ethyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1OCCN(C)C)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C21H29N7O/c1-4-22-21(24-16-20-26-25-19-11-7-8-12-28(19)20)23-15-17-9-5-6-10-18(17)29-14-13-27(2)3/h5-12H,4,13-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | GUPLUJSEWQHUMV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|