C18H23N7O2 — CID 111014033
1-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111014033) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111014033 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1cccnc1OCCOC)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C18H23N7O2/c1-19-18(22-13-16-24-23-15-7-3-4-9-25(15)16)21-12-14-6-5-8-20-17(14)27-11-10-26-2/h3-9H,10-13H2,1-2H3,(H2,19,21,22) |
| InChIKey | YUCFFEIYNSJWHM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|