C20H29IN4O4 — CID 111201211
1-[(3,4-dimethoxyphenyl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 111201211) has the molecular formula C20H29IN4O4 and a molecular weight of 516.38 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111201211 |
| Molecular Formula | C20H29IN4O4 |
| Molecular Weight | 516.38 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[[2-(2-methoxyethoxy)-3-pyridinyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(OC)c(OC)c1)NCc1cccnc1OCCOC.I |
| InChI | InChI=1S/C20H28N4O4.HI/c1-21-20(23-13-15-7-8-17(26-3)18(12-15)27-4)24-14-16-6-5-9-22-19(16)28-11-10-25-2;/h5-9,12H,10-11,13-14H2,1-4H3,(H2,21,23,24);1H |
| InChIKey | JZJLGXQLAAJIBK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|